C30H39ClN6O4 — CID 155336695
2-[4-[(7R)-7'-chloro-2-[(1-methylpyrrolidin-2-yl)methoxy]-8-oxospiro[1,2,3,4,4a,5,6,8a-octahydroquinazoline-7,2'-3H-1-benzofuran]-4-yl]-1-prop-2-enoylpiperazin-2-yl]acetonitrile (PubChem CID 155336695) has the molecular formula C30H39ClN6O4 and a molecular weight of 583.13 g/mol. Its IUPAC name is 2-[4-[(7R)-7'-chloro-2-[(1-methylpyrrolidin-2-yl)methoxy]-8-oxospiro[1,2,3,4,4a,5,6,8a-octahydroquinazoline-7,2'-3H-1-benzofuran]-4-yl]-1-prop-2-enoylpiperazin-2-yl]acetonitrile.
| Compound Name | 2-[4-[(7R)-7'-chloro-2-[(1-methylpyrrolidin-2-yl)methoxy]-8-oxospiro[1,2,3,4,4a,5,6,8a-octahydroquinazoline-7,2'-3H-1-benzofuran]-4-yl]-1-prop-2-enoylpiperazin-2-yl]acetonitrile |
|---|---|
| PubChem CID | 155336695 |
| Molecular Formula | C30H39ClN6O4 |
| Molecular Weight | 583.13 g/mol |
| Exact Mass | 582.27 |
| IUPAC Name | 2-[4-[(7R)-7'-chloro-2-[(1-methylpyrrolidin-2-yl)methoxy]-8-oxospiro[1,2,3,4,4a,5,6,8a-octahydroquinazoline-7,2'-3H-1-benzofuran]-4-yl]-1-prop-2-enoylpiperazin-2-yl]acetonitrile |
| SMILES | C=CC(=O)N1CCN(C2NC(OCC3CCCN3C)NC3C(=O)[C@@]4(CCC32)Cc2cccc(Cl)c2O4)CC1CC#N |
| InChI | InChI=1S/C30H39ClN6O4/c1-3-24(38)37-15-14-36(17-20(37)10-12-32)28-22-9-11-30(16-19-6-4-8-23(31)26(19)41-30)27(39)25(22)33-29(34-28)40-18-21-7-5-13-35(21)2/h3-4,6,8,20-22,25,28-29,33-34H,1,5,7,9-11,13-18H2,2H3/t20?,21?,22?,25?,28?,29?,30-/m1/s1 |
| InChIKey | NIITZRXLVOLVFI-CYCRYOLQSA-N |
| XLogP | 1.89 |
| TPSA | 110.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.13 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|