C31H42N6O5 — CID 167092491
2-[4-[(7R)-7'-methoxy-2-[(1-methylpyrrolidin-2-yl)methoxy]-8-oxospiro[1,2,3,4,4a,5,6,8a-octahydroquinazoline-7,2'-3H-1-benzofuran]-4-yl]-1-prop-2-enoylpiperazin-2-yl]acetonitrile (PubChem CID 167092491) has the molecular formula C31H42N6O5 and a molecular weight of 578.71 g/mol. Its IUPAC name is 2-[4-[(7R)-7'-methoxy-2-[(1-methylpyrrolidin-2-yl)methoxy]-8-oxospiro[1,2,3,4,4a,5,6,8a-octahydroquinazoline-7,2'-3H-1-benzofuran]-4-yl]-1-prop-2-enoylpiperazin-2-yl]acetonitrile.
| Compound Name | 2-[4-[(7R)-7'-methoxy-2-[(1-methylpyrrolidin-2-yl)methoxy]-8-oxospiro[1,2,3,4,4a,5,6,8a-octahydroquinazoline-7,2'-3H-1-benzofuran]-4-yl]-1-prop-2-enoylpiperazin-2-yl]acetonitrile |
|---|---|
| PubChem CID | 167092491 |
| Molecular Formula | C31H42N6O5 |
| Molecular Weight | 578.71 g/mol |
| Exact Mass | 578.32 |
| IUPAC Name | 2-[4-[(7R)-7'-methoxy-2-[(1-methylpyrrolidin-2-yl)methoxy]-8-oxospiro[1,2,3,4,4a,5,6,8a-octahydroquinazoline-7,2'-3H-1-benzofuran]-4-yl]-1-prop-2-enoylpiperazin-2-yl]acetonitrile |
| SMILES | C=CC(=O)N1CCN(C2NC(OCC3CCCN3C)NC3C(=O)[C@@]4(CCC32)Cc2cccc(OC)c2O4)CC1CC#N |
| InChI | InChI=1S/C31H42N6O5/c1-4-25(38)37-16-15-36(18-21(37)11-13-32)29-23-10-12-31(17-20-7-5-9-24(40-3)27(20)42-31)28(39)26(23)33-30(34-29)41-19-22-8-6-14-35(22)2/h4-5,7,9,21-23,26,29-30,33-34H,1,6,8,10-12,14-19H2,2-3H3/t21?,22?,23?,26?,29?,30?,31-/m1/s1 |
| InChIKey | UPHBNVTWAZBGCE-XOZAWUMBSA-N |
| XLogP | 1.24 |
| TPSA | 119.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.71 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|