C25H25ClN2O — CID 155337461
[4-[[4-(6-chloroquinolin-7-yl)phenyl]methyl]piperidin-1-yl]-cyclopropylmethanone (PubChem CID 155337461) has the molecular formula C25H25ClN2O and a molecular weight of 404.94 g/mol. Its IUPAC name is [4-[[4-(6-chloroquinolin-7-yl)phenyl]methyl]piperidin-1-yl]-cyclopropylmethanone.
| Compound Name | [4-[[4-(6-chloroquinolin-7-yl)phenyl]methyl]piperidin-1-yl]-cyclopropylmethanone |
|---|---|
| PubChem CID | 155337461 |
| Molecular Formula | C25H25ClN2O |
| Molecular Weight | 404.94 g/mol |
| Exact Mass | 404.17 |
| IUPAC Name | [4-[[4-(6-chloroquinolin-7-yl)phenyl]methyl]piperidin-1-yl]-cyclopropylmethanone |
| SMILES | O=C(C1CC1)N1CCC(Cc2ccc(-c3cc4ncccc4cc3Cl)cc2)CC1 |
| InChI | InChI=1S/C25H25ClN2O/c26-23-15-21-2-1-11-27-24(21)16-22(23)19-5-3-17(4-6-19)14-18-9-12-28(13-10-18)25(29)20-7-8-20/h1-6,11,15-16,18,20H,7-10,12-14H2 |
| InChIKey | YEHIHVMTSOGUKB-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.94 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |