C15H7F8N5O — CID 155338016
6-[5-fluoro-6-[(1R)-2,2,3,3-tetrafluorocyclobutyl]oxy-3-pyridinyl]-3-(trifluoromethyl)-[1,2,4]triazolo[4,3-b]pyridazine (PubChem CID 155338016) has the molecular formula C15H7F8N5O and a molecular weight of 425.24 g/mol. Its IUPAC name is 6-[5-fluoro-6-[(1R)-2,2,3,3-tetrafluorocyclobutyl]oxy-3-pyridinyl]-3-(trifluoromethyl)-[1,2,4]triazolo[4,3-b]pyridazine.
| Compound Name | 6-[5-fluoro-6-[(1R)-2,2,3,3-tetrafluorocyclobutyl]oxy-3-pyridinyl]-3-(trifluoromethyl)-[1,2,4]triazolo[4,3-b]pyridazine |
|---|---|
| PubChem CID | 155338016 |
| Molecular Formula | C15H7F8N5O |
| Molecular Weight | 425.24 g/mol |
| Exact Mass | 425.05 |
| IUPAC Name | 6-[5-fluoro-6-[(1R)-2,2,3,3-tetrafluorocyclobutyl]oxy-3-pyridinyl]-3-(trifluoromethyl)-[1,2,4]triazolo[4,3-b]pyridazine |
| SMILES | Fc1cc(-c2ccc3nnc(C(F)(F)F)n3n2)cnc1O[C@@H]1CC(F)(F)C1(F)F |
| InChI | InChI=1S/C15H7F8N5O/c16-7-3-6(5-24-11(7)29-9-4-13(17,18)14(9,19)20)8-1-2-10-25-26-12(15(21,22)23)28(10)27-8/h1-3,5,9H,4H2/t9-/m1/s1 |
| InChIKey | OTHHAJDGBVTDCF-SECBINFHSA-N |
| XLogP | 3.77 |
| TPSA | 65.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.24 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|