C18H12F7N5O — CID 142362463
6-[5-fluoro-6-[4-(trifluoromethyl)hex-5-ynoxy]-3-pyridinyl]-3-(trifluoromethyl)-[1,2,4]triazolo[4,3-b]pyridazine (PubChem CID 142362463) has the molecular formula C18H12F7N5O and a molecular weight of 447.31 g/mol. Its IUPAC name is 6-[5-fluoro-6-[4-(trifluoromethyl)hex-5-ynoxy]-3-pyridinyl]-3-(trifluoromethyl)-[1,2,4]triazolo[4,3-b]pyridazine.
| Compound Name | 6-[5-fluoro-6-[4-(trifluoromethyl)hex-5-ynoxy]-3-pyridinyl]-3-(trifluoromethyl)-[1,2,4]triazolo[4,3-b]pyridazine |
|---|---|
| PubChem CID | 142362463 |
| Molecular Formula | C18H12F7N5O |
| Molecular Weight | 447.31 g/mol |
| Exact Mass | 447.09 |
| IUPAC Name | 6-[5-fluoro-6-[4-(trifluoromethyl)hex-5-ynoxy]-3-pyridinyl]-3-(trifluoromethyl)-[1,2,4]triazolo[4,3-b]pyridazine |
| SMILES | C#CC(CCCOc1ncc(-c2ccc3nnc(C(F)(F)F)n3n2)cc1F)C(F)(F)F |
| InChI | InChI=1S/C18H12F7N5O/c1-2-11(17(20,21)22)4-3-7-31-15-12(19)8-10(9-26-15)13-5-6-14-27-28-16(18(23,24)25)30(14)29-13/h1,5-6,8-9,11H,3-4,7H2 |
| InChIKey | KDUOUMIDSADWGW-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 65.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.31 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|