C21H22N2O3 — CID 155339286
2-[3-(cyclopropylmethoxy)-4-methoxyphenyl]-3-(2,6-dimethyl-4-oxo-1-pyridinyl)prop-2-enenitrile (PubChem CID 155339286) has the molecular formula C21H22N2O3 and a molecular weight of 350.42 g/mol. Its IUPAC name is 2-[3-(cyclopropylmethoxy)-4-methoxyphenyl]-3-(2,6-dimethyl-4-oxo-1-pyridinyl)prop-2-enenitrile.
| Compound Name | 2-[3-(cyclopropylmethoxy)-4-methoxyphenyl]-3-(2,6-dimethyl-4-oxo-1-pyridinyl)prop-2-enenitrile |
|---|---|
| PubChem CID | 155339286 |
| Molecular Formula | C21H22N2O3 |
| Molecular Weight | 350.42 g/mol |
| Exact Mass | 350.16 |
| IUPAC Name | 2-[3-(cyclopropylmethoxy)-4-methoxyphenyl]-3-(2,6-dimethyl-4-oxo-1-pyridinyl)prop-2-enenitrile |
| SMILES | COc1ccc(C(C#N)=Cn2c(C)cc(=O)cc2C)cc1OCC1CC1 |
| InChI | InChI=1S/C21H22N2O3/c1-14-8-19(24)9-15(2)23(14)12-18(11-22)17-6-7-20(25-3)21(10-17)26-13-16-4-5-16/h6-10,12,16H,4-5,13H2,1-3H3 |
| InChIKey | URKMASJKHXXJHZ-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 64.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.42 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|