C19H23NO4 — CID 175241657
3-(cyclopropylmethoxy)-N-(3-formyl-2-methylcyclopenten-1-yl)-4-methoxybenzamide (PubChem CID 175241657) has the molecular formula C19H23NO4 and a molecular weight of 329.40 g/mol. Its IUPAC name is 3-(cyclopropylmethoxy)-N-(3-formyl-2-methylcyclopenten-1-yl)-4-methoxybenzamide.
| Compound Name | 3-(cyclopropylmethoxy)-N-(3-formyl-2-methylcyclopenten-1-yl)-4-methoxybenzamide |
|---|---|
| PubChem CID | 175241657 |
| Molecular Formula | C19H23NO4 |
| Molecular Weight | 329.40 g/mol |
| Exact Mass | 329.16 |
| IUPAC Name | 3-(cyclopropylmethoxy)-N-(3-formyl-2-methylcyclopenten-1-yl)-4-methoxybenzamide |
| SMILES | COc1ccc(C(=O)NC2=C(C)C(C=O)CC2)cc1OCC1CC1 |
| InChI | InChI=1S/C19H23NO4/c1-12-15(10-21)5-7-16(12)20-19(22)14-6-8-17(23-2)18(9-14)24-11-13-3-4-13/h6,8-10,13,15H,3-5,7,11H2,1-2H3,(H,20,22) |
| InChIKey | IRJWFQCMGAAVCE-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.40 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|