C27H31NO4 — CID 175240155
N-(2-benzyl-3-formylcyclohexen-1-yl)-3-cyclopentyloxy-4-methoxybenzamide (PubChem CID 175240155) has the molecular formula C27H31NO4 and a molecular weight of 433.55 g/mol. Its IUPAC name is N-(2-benzyl-3-formylcyclohexen-1-yl)-3-cyclopentyloxy-4-methoxybenzamide.
| Compound Name | N-(2-benzyl-3-formylcyclohexen-1-yl)-3-cyclopentyloxy-4-methoxybenzamide |
|---|---|
| PubChem CID | 175240155 |
| Molecular Formula | C27H31NO4 |
| Molecular Weight | 433.55 g/mol |
| Exact Mass | 433.23 |
| IUPAC Name | N-(2-benzyl-3-formylcyclohexen-1-yl)-3-cyclopentyloxy-4-methoxybenzamide |
| SMILES | COc1ccc(C(=O)NC2=C(Cc3ccccc3)C(C=O)CCC2)cc1OC1CCCC1 |
| InChI | InChI=1S/C27H31NO4/c1-31-25-15-14-20(17-26(25)32-22-11-5-6-12-22)27(30)28-24-13-7-10-21(18-29)23(24)16-19-8-3-2-4-9-19/h2-4,8-9,14-15,17-18,21-22H,5-7,10-13,16H2,1H3,(H,28,30) |
| InChIKey | HFPUFXWRAZVWEC-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.55 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|