C20H20ClNO7S — CID 155339715
9-chloro-1-cyclopropyl-8-(2-ethoxyethoxy)-2,6,6-trioxo-5H-thiochromeno[4,3-b]pyridine-3-carboxylic acid (PubChem CID 155339715) has the molecular formula C20H20ClNO7S and a molecular weight of 453.90 g/mol. Its IUPAC name is 9-chloro-1-cyclopropyl-8-(2-ethoxyethoxy)-2,6,6-trioxo-5H-thiochromeno[4,3-b]pyridine-3-carboxylic acid.
| Compound Name | 9-chloro-1-cyclopropyl-8-(2-ethoxyethoxy)-2,6,6-trioxo-5H-thiochromeno[4,3-b]pyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 155339715 |
| Molecular Formula | C20H20ClNO7S |
| Molecular Weight | 453.90 g/mol |
| Exact Mass | 453.06 |
| IUPAC Name | 9-chloro-1-cyclopropyl-8-(2-ethoxyethoxy)-2,6,6-trioxo-5H-thiochromeno[4,3-b]pyridine-3-carboxylic acid |
| SMILES | CCOCCOc1cc2c(cc1Cl)-c1c(cc(C(=O)O)c(=O)n1C1CC1)CS2(=O)=O |
| InChI | InChI=1S/C20H20ClNO7S/c1-2-28-5-6-29-16-9-17-13(8-15(16)21)18-11(10-30(17,26)27)7-14(20(24)25)19(23)22(18)12-3-4-12/h7-9,12H,2-6,10H2,1H3,(H,24,25) |
| InChIKey | VSRPNSCSMGZTGJ-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 111.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.90 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|