C22H24ClNO5S — CID 155339793
9-chloro-1-cyclobutyl-8-(3-methoxypropoxy)-5-methyl-2-oxo-5H-thiochromeno[4,3-b]pyridine-3-carboxylic acid (PubChem CID 155339793) has the molecular formula C22H24ClNO5S and a molecular weight of 449.96 g/mol. Its IUPAC name is 9-chloro-1-cyclobutyl-8-(3-methoxypropoxy)-5-methyl-2-oxo-5H-thiochromeno[4,3-b]pyridine-3-carboxylic acid.
| Compound Name | 9-chloro-1-cyclobutyl-8-(3-methoxypropoxy)-5-methyl-2-oxo-5H-thiochromeno[4,3-b]pyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 155339793 |
| Molecular Formula | C22H24ClNO5S |
| Molecular Weight | 449.96 g/mol |
| Exact Mass | 449.11 |
| IUPAC Name | 9-chloro-1-cyclobutyl-8-(3-methoxypropoxy)-5-methyl-2-oxo-5H-thiochromeno[4,3-b]pyridine-3-carboxylic acid |
| SMILES | COCCCOc1cc2c(cc1Cl)-c1c(cc(C(=O)O)c(=O)n1C1CCC1)C(C)S2 |
| InChI | InChI=1S/C22H24ClNO5S/c1-12-14-9-16(22(26)27)21(25)24(13-5-3-6-13)20(14)15-10-17(23)18(11-19(15)30-12)29-8-4-7-28-2/h9-13H,3-8H2,1-2H3,(H,26,27) |
| InChIKey | KOYNYHUNURBXAC-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.96 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|