C24H23NO5S2 — CID 155727237
1-cyclopropyl-8-(3-methoxypropoxy)-2-oxo-9-thiophen-3-yl-5H-thiochromeno[4,3-b]pyridine-3-carboxylic acid (PubChem CID 155727237) has the molecular formula C24H23NO5S2 and a molecular weight of 469.58 g/mol. Its IUPAC name is 1-cyclopropyl-8-(3-methoxypropoxy)-2-oxo-9-thiophen-3-yl-5H-thiochromeno[4,3-b]pyridine-3-carboxylic acid.
| Compound Name | 1-cyclopropyl-8-(3-methoxypropoxy)-2-oxo-9-thiophen-3-yl-5H-thiochromeno[4,3-b]pyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 155727237 |
| Molecular Formula | C24H23NO5S2 |
| Molecular Weight | 469.58 g/mol |
| Exact Mass | 469.10 |
| IUPAC Name | 1-cyclopropyl-8-(3-methoxypropoxy)-2-oxo-9-thiophen-3-yl-5H-thiochromeno[4,3-b]pyridine-3-carboxylic acid |
| SMILES | COCCCOc1cc2c(cc1-c1ccsc1)-c1c(cc(C(=O)O)c(=O)n1C1CC1)CS2 |
| InChI | InChI=1S/C24H23NO5S2/c1-29-6-2-7-30-20-11-21-18(10-17(20)14-5-8-31-12-14)22-15(13-32-21)9-19(24(27)28)23(26)25(22)16-3-4-16/h5,8-12,16H,2-4,6-7,13H2,1H3,(H,27,28) |
| InChIKey | SOIVDRTYSYKFCF-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.58 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|