C17H25F2N3O3 — CID 155341727
tert-butyl 3-[1,1-difluoro-4-(hydroxymethyl)pent-4-enyl]-1,4,6,7-tetrahydropyrazolo[4,3-c]pyridine-5-carboxylate (PubChem CID 155341727) has the molecular formula C17H25F2N3O3 and a molecular weight of 357.40 g/mol. Its IUPAC name is tert-butyl 3-[1,1-difluoro-4-(hydroxymethyl)pent-4-enyl]-1,4,6,7-tetrahydropyrazolo[4,3-c]pyridine-5-carboxylate.
| Compound Name | tert-butyl 3-[1,1-difluoro-4-(hydroxymethyl)pent-4-enyl]-1,4,6,7-tetrahydropyrazolo[4,3-c]pyridine-5-carboxylate |
|---|---|
| PubChem CID | 155341727 |
| Molecular Formula | C17H25F2N3O3 |
| Molecular Weight | 357.40 g/mol |
| Exact Mass | 357.19 |
| IUPAC Name | tert-butyl 3-[1,1-difluoro-4-(hydroxymethyl)pent-4-enyl]-1,4,6,7-tetrahydropyrazolo[4,3-c]pyridine-5-carboxylate |
| SMILES | C=C(CO)CCC(F)(F)c1n[nH]c2c1CN(C(=O)OC(C)(C)C)CC2 |
| InChI | InChI=1S/C17H25F2N3O3/c1-11(10-23)5-7-17(18,19)14-12-9-22(8-6-13(12)20-21-14)15(24)25-16(2,3)4/h23H,1,5-10H2,2-4H3,(H,20,21) |
| InChIKey | LTMIBZMQVKZIQS-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 78.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.40 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|