C32H40FN2O5P — CID 155342098
[2-cyclopropyl-2-[3-[3-[[di(propan-2-yl)amino]methyl]-4-(5-fluoro-2-methoxy-4-pyridinyl)benzoyl]oxyphenyl]ethyl]-methylphosphinic acid (PubChem CID 155342098) has the molecular formula C32H40FN2O5P and a molecular weight of 582.65 g/mol. Its IUPAC name is [2-cyclopropyl-2-[3-[3-[[di(propan-2-yl)amino]methyl]-4-(5-fluoro-2-methoxy-4-pyridinyl)benzoyl]oxyphenyl]ethyl]-methylphosphinic acid.
| Compound Name | [2-cyclopropyl-2-[3-[3-[[di(propan-2-yl)amino]methyl]-4-(5-fluoro-2-methoxy-4-pyridinyl)benzoyl]oxyphenyl]ethyl]-methylphosphinic acid |
|---|---|
| PubChem CID | 155342098 |
| Molecular Formula | C32H40FN2O5P |
| Molecular Weight | 582.65 g/mol |
| Exact Mass | 582.27 |
| IUPAC Name | [2-cyclopropyl-2-[3-[3-[[di(propan-2-yl)amino]methyl]-4-(5-fluoro-2-methoxy-4-pyridinyl)benzoyl]oxyphenyl]ethyl]-methylphosphinic acid |
| SMILES | COc1cc(-c2ccc(C(=O)Oc3cccc(C(CP(C)(=O)O)C4CC4)c3)cc2CN(C(C)C)C(C)C)c(F)cn1 |
| InChI | InChI=1S/C32H40FN2O5P/c1-20(2)35(21(3)4)18-25-14-24(12-13-27(25)28-16-31(39-5)34-17-30(28)33)32(36)40-26-9-7-8-23(15-26)29(22-10-11-22)19-41(6,37)38/h7-9,12-17,20-22,29H,10-11,18-19H2,1-6H3,(H,37,38) |
| InChIKey | KUGCENPXLZDHNL-UHFFFAOYSA-N |
| XLogP | 7.13 |
| TPSA | 88.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.65 |
| LogP ≤ 5 | 7.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|