C62H76F2N4O7P+ — CID 175423443
bis[2-cyclopropyl-2-[3-[[3-[[di(propan-2-yl)amino]methyl]-4-(5-fluoro-2-methoxy-4-pyridinyl)phenyl]methoxy]phenyl]ethoxy]-oxophosphanium (PubChem CID 175423443) has the molecular formula C62H76F2N4O7P+ and a molecular weight of 1058.28 g/mol. Its IUPAC name is bis[2-cyclopropyl-2-[3-[[3-[[di(propan-2-yl)amino]methyl]-4-(5-fluoro-2-methoxy-4-pyridinyl)phenyl]methoxy]phenyl]ethoxy]-oxophosphanium.
| Compound Name | bis[2-cyclopropyl-2-[3-[[3-[[di(propan-2-yl)amino]methyl]-4-(5-fluoro-2-methoxy-4-pyridinyl)phenyl]methoxy]phenyl]ethoxy]-oxophosphanium |
|---|---|
| PubChem CID | 175423443 |
| Molecular Formula | C62H76F2N4O7P+ |
| Molecular Weight | 1058.28 g/mol |
| Exact Mass | 1057.54 |
| IUPAC Name | bis[2-cyclopropyl-2-[3-[[3-[[di(propan-2-yl)amino]methyl]-4-(5-fluoro-2-methoxy-4-pyridinyl)phenyl]methoxy]phenyl]ethoxy]-oxophosphanium |
| SMILES | COc1cc(-c2ccc(COc3cccc(C(CO[P+](=O)OCC(c4cccc(OCc5ccc(-c6cc(OC)ncc6F)c(CN(C(C)C)C(C)C)c5)c4)C4CC4)C4CC4)c3)cc2CN(C(C)C)C(C)C)c(F)cn1 |
| InChI | InChI=1S/C62H76F2N4O7P/c1-39(2)67(40(3)4)33-49-25-43(17-23-53(49)55-29-61(70-9)65-31-59(55)63)35-72-51-15-11-13-47(27-51)57(45-19-20-45)37-74-76(69)75-38-58(46-21-22-46)48-14-12-16-52(28-48)73-36-44-18-24-54(56-30-62(71-10)66-32-60(56)64)50(26-44)34-68(41(5)6)42(7)8/h11-18,23-32,39-42,45-46,57-58H,19-22,33-38H2,1-10H3/q+1 |
| InChIKey | OEHQPIHUWRQTSF-UHFFFAOYSA-N |
| XLogP | 14.88 |
| TPSA | 104.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 28 |
| Heavy Atoms | 76 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1058.28 |
| LogP ≤ 5 | 14.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|