C17H22N4O3 — CID 155343545
tert-butyl 3-oxa-4,11,12,15-tetrazatetracyclo[8.7.0.02,6.012,17]heptadeca-1(17),2(6),4,10-tetraene-15-carboxylate (PubChem CID 155343545) has the molecular formula C17H22N4O3 and a molecular weight of 330.39 g/mol. Its IUPAC name is tert-butyl 3-oxa-4,11,12,15-tetrazatetracyclo[8.7.0.02,6.012,17]heptadeca-1(17),2(6),4,10-tetraene-15-carboxylate.
| Compound Name | tert-butyl 3-oxa-4,11,12,15-tetrazatetracyclo[8.7.0.02,6.012,17]heptadeca-1(17),2(6),4,10-tetraene-15-carboxylate |
|---|---|
| PubChem CID | 155343545 |
| Molecular Formula | C17H22N4O3 |
| Molecular Weight | 330.39 g/mol |
| Exact Mass | 330.17 |
| IUPAC Name | tert-butyl 3-oxa-4,11,12,15-tetrazatetracyclo[8.7.0.02,6.012,17]heptadeca-1(17),2(6),4,10-tetraene-15-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCn2nc3c(c2C1)-c1oncc1CCC3 |
| InChI | InChI=1S/C17H22N4O3/c1-17(2,3)23-16(22)20-7-8-21-13(10-20)14-12(19-21)6-4-5-11-9-18-24-15(11)14/h9H,4-8,10H2,1-3H3 |
| InChIKey | BJBAITIBMNLDSH-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 73.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.39 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |