C14H20IN3O4 — CID 169126195
5-O-tert-butyl 2-O-methyl 3-iodo-4,6,7,8-tetrahydropyrazolo[1,5-a][1,4]diazepine-2,5-dicarboxylate (PubChem CID 169126195) has the molecular formula C14H20IN3O4 and a molecular weight of 421.24 g/mol. Its IUPAC name is 5-O-tert-butyl 2-O-methyl 3-iodo-4,6,7,8-tetrahydropyrazolo[1,5-a][1,4]diazepine-2,5-dicarboxylate.
| Compound Name | 5-O-tert-butyl 2-O-methyl 3-iodo-4,6,7,8-tetrahydropyrazolo[1,5-a][1,4]diazepine-2,5-dicarboxylate |
|---|---|
| PubChem CID | 169126195 |
| Molecular Formula | C14H20IN3O4 |
| Molecular Weight | 421.24 g/mol |
| Exact Mass | 421.05 |
| IUPAC Name | 5-O-tert-butyl 2-O-methyl 3-iodo-4,6,7,8-tetrahydropyrazolo[1,5-a][1,4]diazepine-2,5-dicarboxylate |
| SMILES | COC(=O)c1nn2c(c1I)CN(C(=O)OC(C)(C)C)CCC2 |
| InChI | InChI=1S/C14H20IN3O4/c1-14(2,3)22-13(20)17-6-5-7-18-9(8-17)10(15)11(16-18)12(19)21-4/h5-8H2,1-4H3 |
| InChIKey | ZMFAYYXULRPJEW-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 73.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.24 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|