C16H25N3O4 — CID 170622132
5-O-tert-butyl 2-O-methyl 3-ethyl-4,6,7,8-tetrahydropyrazolo[1,5-a][1,4]diazepine-2,5-dicarboxylate (PubChem CID 170622132) has the molecular formula C16H25N3O4 and a molecular weight of 323.39 g/mol. Its IUPAC name is 5-O-tert-butyl 2-O-methyl 3-ethyl-4,6,7,8-tetrahydropyrazolo[1,5-a][1,4]diazepine-2,5-dicarboxylate.
| Compound Name | 5-O-tert-butyl 2-O-methyl 3-ethyl-4,6,7,8-tetrahydropyrazolo[1,5-a][1,4]diazepine-2,5-dicarboxylate |
|---|---|
| PubChem CID | 170622132 |
| Molecular Formula | C16H25N3O4 |
| Molecular Weight | 323.39 g/mol |
| Exact Mass | 323.18 |
| IUPAC Name | 5-O-tert-butyl 2-O-methyl 3-ethyl-4,6,7,8-tetrahydropyrazolo[1,5-a][1,4]diazepine-2,5-dicarboxylate |
| SMILES | CCc1c(C(=O)OC)nn2c1CN(C(=O)OC(C)(C)C)CCC2 |
| InChI | InChI=1S/C16H25N3O4/c1-6-11-12-10-18(15(21)23-16(2,3)4)8-7-9-19(12)17-13(11)14(20)22-5/h6-10H2,1-5H3 |
| InChIKey | FDICFKYFTOKHAD-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 73.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.39 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |