C24H34N4O6 — CID 170622436
tert-butyl 2-[(2,4-dimethoxyphenyl)methyl-methylcarbamoyl]-3-(hydroxymethyl)-4,6,7,8-tetrahydropyrazolo[1,5-a][1,4]diazepine-5-carboxylate (PubChem CID 170622436) has the molecular formula C24H34N4O6 and a molecular weight of 474.56 g/mol. Its IUPAC name is tert-butyl 2-[(2,4-dimethoxyphenyl)methyl-methylcarbamoyl]-3-(hydroxymethyl)-4,6,7,8-tetrahydropyrazolo[1,5-a][1,4]diazepine-5-carboxylate.
| Compound Name | tert-butyl 2-[(2,4-dimethoxyphenyl)methyl-methylcarbamoyl]-3-(hydroxymethyl)-4,6,7,8-tetrahydropyrazolo[1,5-a][1,4]diazepine-5-carboxylate |
|---|---|
| PubChem CID | 170622436 |
| Molecular Formula | C24H34N4O6 |
| Molecular Weight | 474.56 g/mol |
| Exact Mass | 474.25 |
| IUPAC Name | tert-butyl 2-[(2,4-dimethoxyphenyl)methyl-methylcarbamoyl]-3-(hydroxymethyl)-4,6,7,8-tetrahydropyrazolo[1,5-a][1,4]diazepine-5-carboxylate |
| SMILES | COc1ccc(CN(C)C(=O)c2nn3c(c2CO)CN(C(=O)OC(C)(C)C)CCC3)c(OC)c1 |
| InChI | InChI=1S/C24H34N4O6/c1-24(2,3)34-23(31)27-10-7-11-28-19(14-27)18(15-29)21(25-28)22(30)26(4)13-16-8-9-17(32-5)12-20(16)33-6/h8-9,12,29H,7,10-11,13-15H2,1-6H3 |
| InChIKey | OFNHZLAYQOOMGT-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 106.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.56 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |