C20H21N5O — CID 155344075
4-(cyclopropylmethyl)-1-(2-pyrimidin-4-ylpyridine-3-carbonyl)piperidine-4-carbonitrile (PubChem CID 155344075) has the molecular formula C20H21N5O and a molecular weight of 347.42 g/mol. Its IUPAC name is 4-(cyclopropylmethyl)-1-(2-pyrimidin-4-ylpyridine-3-carbonyl)piperidine-4-carbonitrile.
| Compound Name | 4-(cyclopropylmethyl)-1-(2-pyrimidin-4-ylpyridine-3-carbonyl)piperidine-4-carbonitrile |
|---|---|
| PubChem CID | 155344075 |
| Molecular Formula | C20H21N5O |
| Molecular Weight | 347.42 g/mol |
| Exact Mass | 347.17 |
| IUPAC Name | 4-(cyclopropylmethyl)-1-(2-pyrimidin-4-ylpyridine-3-carbonyl)piperidine-4-carbonitrile |
| SMILES | N#CC1(CC2CC2)CCN(C(=O)c2cccnc2-c2ccncn2)CC1 |
| InChI | InChI=1S/C20H21N5O/c21-13-20(12-15-3-4-15)6-10-25(11-7-20)19(26)16-2-1-8-23-18(16)17-5-9-22-14-24-17/h1-2,5,8-9,14-15H,3-4,6-7,10-12H2 |
| InChIKey | RJIUKLMKACBPBZ-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 82.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.42 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |