C24H20ClFN4O — CID 167581350
4-[(4-chloro-2-fluorophenyl)methyl]-1-(2-pyrimidin-4-ylbenzoyl)piperidine-4-carbonitrile (PubChem CID 167581350) has the molecular formula C24H20ClFN4O and a molecular weight of 434.90 g/mol. Its IUPAC name is 4-[(4-chloro-2-fluorophenyl)methyl]-1-(2-pyrimidin-4-ylbenzoyl)piperidine-4-carbonitrile.
| Compound Name | 4-[(4-chloro-2-fluorophenyl)methyl]-1-(2-pyrimidin-4-ylbenzoyl)piperidine-4-carbonitrile |
|---|---|
| PubChem CID | 167581350 |
| Molecular Formula | C24H20ClFN4O |
| Molecular Weight | 434.90 g/mol |
| Exact Mass | 434.13 |
| IUPAC Name | 4-[(4-chloro-2-fluorophenyl)methyl]-1-(2-pyrimidin-4-ylbenzoyl)piperidine-4-carbonitrile |
| SMILES | N#CC1(Cc2ccc(Cl)cc2F)CCN(C(=O)c2ccccc2-c2ccncn2)CC1 |
| InChI | InChI=1S/C24H20ClFN4O/c25-18-6-5-17(21(26)13-18)14-24(15-27)8-11-30(12-9-24)23(31)20-4-2-1-3-19(20)22-7-10-28-16-29-22/h1-7,10,13,16H,8-9,11-12,14H2 |
| InChIKey | IBXCDNJRCQWIJM-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 69.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.90 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |