C27H25FN4S — CID 155351143
1-(5-cyclopropyl-2-pyrimidin-4-ylbenzenecarbothioyl)-4-[(4-fluorophenyl)methyl]piperidine-4-carbonitrile (PubChem CID 155351143) has the molecular formula C27H25FN4S and a molecular weight of 456.59 g/mol. Its IUPAC name is 1-(5-cyclopropyl-2-pyrimidin-4-ylbenzenecarbothioyl)-4-[(4-fluorophenyl)methyl]piperidine-4-carbonitrile.
| Compound Name | 1-(5-cyclopropyl-2-pyrimidin-4-ylbenzenecarbothioyl)-4-[(4-fluorophenyl)methyl]piperidine-4-carbonitrile |
|---|---|
| PubChem CID | 155351143 |
| Molecular Formula | C27H25FN4S |
| Molecular Weight | 456.59 g/mol |
| Exact Mass | 456.18 |
| IUPAC Name | 1-(5-cyclopropyl-2-pyrimidin-4-ylbenzenecarbothioyl)-4-[(4-fluorophenyl)methyl]piperidine-4-carbonitrile |
| SMILES | N#CC1(Cc2ccc(F)cc2)CCN(C(=S)c2cc(C3CC3)ccc2-c2ccncn2)CC1 |
| InChI | InChI=1S/C27H25FN4S/c28-22-6-1-19(2-7-22)16-27(17-29)10-13-32(14-11-27)26(33)24-15-21(20-3-4-20)5-8-23(24)25-9-12-30-18-31-25/h1-2,5-9,12,15,18,20H,3-4,10-11,13-14,16H2 |
| InChIKey | QAOTWUCKLAKMLR-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 52.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.59 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|