C20H25F3N2O2 — CID 155344135
tert-butyl 4-cyano-4-[1-[4-(trifluoromethyl)phenyl]ethyl]piperidine-1-carboxylate (PubChem CID 155344135) has the molecular formula C20H25F3N2O2 and a molecular weight of 382.43 g/mol. Its IUPAC name is tert-butyl 4-cyano-4-[1-[4-(trifluoromethyl)phenyl]ethyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-cyano-4-[1-[4-(trifluoromethyl)phenyl]ethyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 155344135 |
| Molecular Formula | C20H25F3N2O2 |
| Molecular Weight | 382.43 g/mol |
| Exact Mass | 382.19 |
| IUPAC Name | tert-butyl 4-cyano-4-[1-[4-(trifluoromethyl)phenyl]ethyl]piperidine-1-carboxylate |
| SMILES | CC(c1ccc(C(F)(F)F)cc1)C1(C#N)CCN(C(=O)OC(C)(C)C)CC1 |
| InChI | InChI=1S/C20H25F3N2O2/c1-14(15-5-7-16(8-6-15)20(21,22)23)19(13-24)9-11-25(12-10-19)17(26)27-18(2,3)4/h5-8,14H,9-12H2,1-4H3 |
| InChIKey | WCOCZZPTTZUBAO-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 53.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.43 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |