C17H22F3NO3 — CID 151071009
tert-butyl 3-[1-[4-(trifluoromethyl)phenyl]ethoxy]azetidine-1-carboxylate (PubChem CID 151071009) has the molecular formula C17H22F3NO3 and a molecular weight of 345.36 g/mol. Its IUPAC name is tert-butyl 3-[1-[4-(trifluoromethyl)phenyl]ethoxy]azetidine-1-carboxylate.
| Compound Name | tert-butyl 3-[1-[4-(trifluoromethyl)phenyl]ethoxy]azetidine-1-carboxylate |
|---|---|
| PubChem CID | 151071009 |
| Molecular Formula | C17H22F3NO3 |
| Molecular Weight | 345.36 g/mol |
| Exact Mass | 345.16 |
| IUPAC Name | tert-butyl 3-[1-[4-(trifluoromethyl)phenyl]ethoxy]azetidine-1-carboxylate |
| SMILES | CC(OC1CN(C(=O)OC(C)(C)C)C1)c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C17H22F3NO3/c1-11(12-5-7-13(8-6-12)17(18,19)20)23-14-9-21(10-14)15(22)24-16(2,3)4/h5-8,11,14H,9-10H2,1-4H3 |
| InChIKey | MICZKADRSGOHCA-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.36 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |