C19H22F3NO3 — CID 171092842
tert-butyl 3-[3-hydroxy-3-[4-(trifluoromethyl)phenyl]prop-1-ynyl]pyrrolidine-1-carboxylate (PubChem CID 171092842) has the molecular formula C19H22F3NO3 and a molecular weight of 369.38 g/mol. Its IUPAC name is tert-butyl 3-[3-hydroxy-3-[4-(trifluoromethyl)phenyl]prop-1-ynyl]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl 3-[3-hydroxy-3-[4-(trifluoromethyl)phenyl]prop-1-ynyl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 171092842 |
| Molecular Formula | C19H22F3NO3 |
| Molecular Weight | 369.38 g/mol |
| Exact Mass | 369.16 |
| IUPAC Name | tert-butyl 3-[3-hydroxy-3-[4-(trifluoromethyl)phenyl]prop-1-ynyl]pyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(C#CC(O)c2ccc(C(F)(F)F)cc2)C1 |
| InChI | InChI=1S/C19H22F3NO3/c1-18(2,3)26-17(25)23-11-10-13(12-23)4-9-16(24)14-5-7-15(8-6-14)19(20,21)22/h5-8,13,16,24H,10-12H2,1-3H3 |
| InChIKey | KHCJYPNDCYMUNL-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.38 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|