About 2-(2,6-difluorophenyl)-4-[3-(methyliminomethyl)phenyl]phthalazin-1-one;hydrate
2-(2,6-difluorophenyl)-4-[3-(methyliminomethyl)phenyl]phthalazin-1-one;hydrate (PubChem CID 155346089) has the molecular formula C22H17F2N3O2
and a molecular weight of 393.39 g/mol. Its IUPAC name is 2-(2,6-difluorophenyl)-4-[3-(methyliminomethyl)phenyl]phthalazin-1-one;hydrate.
Molecular Properties
| Compound Name | 2-(2,6-difluorophenyl)-4-[3-(methyliminomethyl)phenyl]phthalazin-1-one;hydrate |
| PubChem CID | 155346089 |
| Molecular Formula | C22H17F2N3O2 |
| Molecular Weight | 393.39 g/mol |
| Exact Mass | 393.13 |
| IUPAC Name | 2-(2,6-difluorophenyl)-4-[3-(methyliminomethyl)phenyl]phthalazin-1-one;hydrate |
| SMILES | C/N=C/c1cccc(-c2nn(-c3c(F)cccc3F)c(=O)c3ccccc23)c1.O |
| InChI | InChI=1S/C22H15F2N3O.H2O/c1-25-13-14-6-4-7-15(12-14)20-16-8-2-3-9-17(16)22(28)27(26-20)21-18(23)10-5-11-19(21)24;/h2-13H,1H3;1H2/b25-13+; |
| InChIKey | YUIANCMCBABGKJ-FEIRLWDVSA-N |
| XLogP | 3.55 |
| TPSA | 78.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 393.39 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 2-(2,6-difluorophenyl)-4-[3-(methyliminomethyl)phenyl]phthalazin-1-one;hydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2,6-difluorophenyl)-4-[3-(methyliminomethyl)phenyl]phthalazin-1-one;hydrate?
The IUPAC name of 2-(2,6-difluorophenyl)-4-[3-(methyliminomethyl)phenyl]phthalazin-1-one;hydrate (CID 155346089) is 2-(2,6-difluorophenyl)-4-[3-(methyliminomethyl)phenyl]phthalazin-1-one;hydrate.
What is the SMILES notation for 2-(2,6-difluorophenyl)-4-[3-(methyliminomethyl)phenyl]phthalazin-1-one;hydrate?
The canonical SMILES for 2-(2,6-difluorophenyl)-4-[3-(methyliminomethyl)phenyl]phthalazin-1-one;hydrate is C/N=C/c1cccc(-c2nn(-c3c(F)cccc3F)c(=O)c3ccccc23)c1.O.
What is the InChIKey of 2-(2,6-difluorophenyl)-4-[3-(methyliminomethyl)phenyl]phthalazin-1-one;hydrate?
The InChIKey is YUIANCMCBABGKJ-FEIRLWDVSA-N. The full InChI is InChI=1S/C22H15F2N3O.H2O/c1-25-13-14-6-4-7-15(12-14)20-16-8-2-3-9-17(16)22(28)27(26-20)21-18(23)10-5-11-19(21)24;/h2-13H,1H3;1H2/b25-13+;.
What are the key properties of 2-(2,6-difluorophenyl)-4-[3-(methyliminomethyl)phenyl]phthalazin-1-one;hydrate?
2-(2,6-difluorophenyl)-4-[3-(methyliminomethyl)phenyl]phthalazin-1-one;hydrate has a molecular weight of 393.39 g/mol, XLogP of 3.55, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2,6-difluorophenyl)-4-[3-(methyliminomethyl)phenyl]phthalazin-1-one;hydrate is sourced from PubChem (CID 155346089), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).