C22H13F5N2O2 — CID 136716578
4-(4-hydroxy-3,5-dimethylphenyl)-2-(2,3,4,5,6-pentafluorophenyl)phthalazin-1-one (PubChem CID 136716578) has the molecular formula C22H13F5N2O2 and a molecular weight of 432.35 g/mol. Its IUPAC name is 4-(4-hydroxy-3,5-dimethylphenyl)-2-(2,3,4,5,6-pentafluorophenyl)phthalazin-1-one.
| Compound Name | 4-(4-hydroxy-3,5-dimethylphenyl)-2-(2,3,4,5,6-pentafluorophenyl)phthalazin-1-one |
|---|---|
| PubChem CID | 136716578 |
| Molecular Formula | C22H13F5N2O2 |
| Molecular Weight | 432.35 g/mol |
| Exact Mass | 432.09 |
| IUPAC Name | 4-(4-hydroxy-3,5-dimethylphenyl)-2-(2,3,4,5,6-pentafluorophenyl)phthalazin-1-one |
| SMILES | Cc1cc(-c2nn(-c3c(F)c(F)c(F)c(F)c3F)c(=O)c3ccccc23)cc(C)c1O |
| InChI | InChI=1S/C22H13F5N2O2/c1-9-7-11(8-10(2)21(9)30)19-12-5-3-4-6-13(12)22(31)29(28-19)20-17(26)15(24)14(23)16(25)18(20)27/h3-8,30H,1-2H3 |
| InChIKey | DKSBAXPEPXPVJO-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.35 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|