C28H24N4O2 — CID 101204421
4-[4-(4-aminophenoxy)-3,5-dimethylphenyl]-2-(4-aminophenyl)phthalazin-1-one (PubChem CID 101204421) has the molecular formula C28H24N4O2 and a molecular weight of 448.53 g/mol. Its IUPAC name is 4-[4-(4-aminophenoxy)-3,5-dimethylphenyl]-2-(4-aminophenyl)phthalazin-1-one.
| Compound Name | 4-[4-(4-aminophenoxy)-3,5-dimethylphenyl]-2-(4-aminophenyl)phthalazin-1-one |
|---|---|
| PubChem CID | 101204421 |
| Molecular Formula | C28H24N4O2 |
| Molecular Weight | 448.53 g/mol |
| Exact Mass | 448.19 |
| IUPAC Name | 4-[4-(4-aminophenoxy)-3,5-dimethylphenyl]-2-(4-aminophenyl)phthalazin-1-one |
| SMILES | Cc1cc(-c2nn(-c3ccc(N)cc3)c(=O)c3ccccc23)cc(C)c1Oc1ccc(N)cc1 |
| InChI | InChI=1S/C28H24N4O2/c1-17-15-19(16-18(2)27(17)34-23-13-9-21(30)10-14-23)26-24-5-3-4-6-25(24)28(33)32(31-26)22-11-7-20(29)8-12-22/h3-16H,29-30H2,1-2H3 |
| InChIKey | VPABDMFJTCUIAJ-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 96.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.53 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|