C25H20N6O4 — CID 134597124
3-[3-[4-(4-aminophenyl)-1-oxophthalazin-2-yl]-4-methoxyphenyl]-5-methyltriazole-4-carboxylic acid (PubChem CID 134597124) has the molecular formula C25H20N6O4 and a molecular weight of 468.47 g/mol. Its IUPAC name is 3-[3-[4-(4-aminophenyl)-1-oxophthalazin-2-yl]-4-methoxyphenyl]-5-methyltriazole-4-carboxylic acid.
| Compound Name | 3-[3-[4-(4-aminophenyl)-1-oxophthalazin-2-yl]-4-methoxyphenyl]-5-methyltriazole-4-carboxylic acid |
|---|---|
| PubChem CID | 134597124 |
| Molecular Formula | C25H20N6O4 |
| Molecular Weight | 468.47 g/mol |
| Exact Mass | 468.15 |
| IUPAC Name | 3-[3-[4-(4-aminophenyl)-1-oxophthalazin-2-yl]-4-methoxyphenyl]-5-methyltriazole-4-carboxylic acid |
| SMILES | COc1ccc(-n2nnc(C)c2C(=O)O)cc1-n1nc(-c2ccc(N)cc2)c2ccccc2c1=O |
| InChI | InChI=1S/C25H20N6O4/c1-14-23(25(33)34)30(29-27-14)17-11-12-21(35-2)20(13-17)31-24(32)19-6-4-3-5-18(19)22(28-31)15-7-9-16(26)10-8-15/h3-13H,26H2,1-2H3,(H,33,34) |
| InChIKey | MOEJBYIBWZRRHG-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 138.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.47 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|