C40H28N4O5 — CID 101171416
3-[[4-[4-[4-(4-aminophenoxy)-3-phenylphenyl]-1-oxophthalazin-2-yl]phenyl]carbamoyl]benzoic acid (PubChem CID 101171416) has the molecular formula C40H28N4O5 and a molecular weight of 644.69 g/mol. Its IUPAC name is 3-[[4-[4-[4-(4-aminophenoxy)-3-phenylphenyl]-1-oxophthalazin-2-yl]phenyl]carbamoyl]benzoic acid.
| Compound Name | 3-[[4-[4-[4-(4-aminophenoxy)-3-phenylphenyl]-1-oxophthalazin-2-yl]phenyl]carbamoyl]benzoic acid |
|---|---|
| PubChem CID | 101171416 |
| Molecular Formula | C40H28N4O5 |
| Molecular Weight | 644.69 g/mol |
| Exact Mass | 644.21 |
| IUPAC Name | 3-[[4-[4-[4-(4-aminophenoxy)-3-phenylphenyl]-1-oxophthalazin-2-yl]phenyl]carbamoyl]benzoic acid |
| SMILES | Nc1ccc(Oc2ccc(-c3nn(-c4ccc(NC(=O)c5cccc(C(=O)O)c5)cc4)c(=O)c4ccccc34)cc2-c2ccccc2)cc1 |
| InChI | InChI=1S/C40H28N4O5/c41-29-14-20-32(21-15-29)49-36-22-13-26(24-35(36)25-7-2-1-3-8-25)37-33-11-4-5-12-34(33)39(46)44(43-37)31-18-16-30(17-19-31)42-38(45)27-9-6-10-28(23-27)40(47)48/h1-24H,41H2,(H,42,45)(H,47,48) |
| InChIKey | OMMIOYICCPODCR-UHFFFAOYSA-N |
| XLogP | 8.04 |
| TPSA | 136.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 644.69 |
| LogP ≤ 5 | 8.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|