C17H28F2N2OS — CID 155347376
2-cyclohexyl-N-[2-[2-(2,2-difluoroethoxy)-4-ethyl-1,3-thiazol-5-yl]ethyl]ethanamine (PubChem CID 155347376) has the molecular formula C17H28F2N2OS and a molecular weight of 346.49 g/mol. Its IUPAC name is 2-cyclohexyl-N-[2-[2-(2,2-difluoroethoxy)-4-ethyl-1,3-thiazol-5-yl]ethyl]ethanamine.
| Compound Name | 2-cyclohexyl-N-[2-[2-(2,2-difluoroethoxy)-4-ethyl-1,3-thiazol-5-yl]ethyl]ethanamine |
|---|---|
| PubChem CID | 155347376 |
| Molecular Formula | C17H28F2N2OS |
| Molecular Weight | 346.49 g/mol |
| Exact Mass | 346.19 |
| IUPAC Name | 2-cyclohexyl-N-[2-[2-(2,2-difluoroethoxy)-4-ethyl-1,3-thiazol-5-yl]ethyl]ethanamine |
| SMILES | CCc1nc(OCC(F)F)sc1CCNCCC1CCCCC1 |
| InChI | InChI=1S/C17H28F2N2OS/c1-2-14-15(23-17(21-14)22-12-16(18)19)9-11-20-10-8-13-6-4-3-5-7-13/h13,16,20H,2-12H2,1H3 |
| InChIKey | IJSYTJIHHUFXQN-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.49 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|