C20H34O6 — CID 155348994
ethyl 4-hydroxy-4-[(2-hydroxy-3,7-dimethyl-2-bicyclo[3.3.1]nonanyl)peroxy]cyclohexane-1-carboxylate (PubChem CID 155348994) has the molecular formula C20H34O6 and a molecular weight of 370.49 g/mol. Its IUPAC name is ethyl 4-hydroxy-4-[(2-hydroxy-3,7-dimethyl-2-bicyclo[3.3.1]nonanyl)peroxy]cyclohexane-1-carboxylate.
| Compound Name | ethyl 4-hydroxy-4-[(2-hydroxy-3,7-dimethyl-2-bicyclo[3.3.1]nonanyl)peroxy]cyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 155348994 |
| Molecular Formula | C20H34O6 |
| Molecular Weight | 370.49 g/mol |
| Exact Mass | 370.24 |
| IUPAC Name | ethyl 4-hydroxy-4-[(2-hydroxy-3,7-dimethyl-2-bicyclo[3.3.1]nonanyl)peroxy]cyclohexane-1-carboxylate |
| SMILES | CCOC(=O)C1CCC(O)(OOC2(O)C(C)CC3CC(C)CC2C3)CC1 |
| InChI | InChI=1S/C20H34O6/c1-4-24-18(21)16-5-7-19(22,8-6-16)25-26-20(23)14(3)11-15-9-13(2)10-17(20)12-15/h13-17,22-23H,4-12H2,1-3H3 |
| InChIKey | LSOFTBNEJNIDDX-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 85.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.49 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|