C6H13N3 — CID 155354245
(Z,2R)-5-methyliminopent-3-ene-2,3-diamine (PubChem CID 155354245) has the molecular formula C6H13N3 and a molecular weight of 127.19 g/mol. Its IUPAC name is (Z,2R)-5-methyliminopent-3-ene-2,3-diamine.
| Compound Name | (Z,2R)-5-methyliminopent-3-ene-2,3-diamine |
|---|---|
| PubChem CID | 155354245 |
| Molecular Formula | C6H13N3 |
| Molecular Weight | 127.19 g/mol |
| Exact Mass | 127.11 |
| IUPAC Name | (Z,2R)-5-methyliminopent-3-ene-2,3-diamine |
| SMILES | C/N=C/C=C(\N)[C@@H](C)N |
| InChI | InChI=1S/C6H13N3/c1-5(7)6(8)3-4-9-2/h3-5H,7-8H2,1-2H3/b6-3-,9-4+/t5-/m1/s1 |
| InChIKey | ZHAWFCDOWBVIGW-KKQPIXSVSA-N |
| XLogP | -0.12 |
| TPSA | 64.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 127.19 |
| LogP ≤ 5 | -0.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|