C6H12N4 — CID 67781597
3-methyl-2H-pyridine-2,3,5-triamine (PubChem CID 67781597) has the molecular formula C6H12N4 and a molecular weight of 140.19 g/mol. Its IUPAC name is 3-methyl-2H-pyridine-2,3,5-triamine.
| Compound Name | 3-methyl-2H-pyridine-2,3,5-triamine |
|---|---|
| PubChem CID | 67781597 |
| Molecular Formula | C6H12N4 |
| Molecular Weight | 140.19 g/mol |
| Exact Mass | 140.11 |
| IUPAC Name | 3-methyl-2H-pyridine-2,3,5-triamine |
| SMILES | CC1(N)C=C(N)C=NC1N |
| InChI | InChI=1S/C6H12N4/c1-6(9)2-4(7)3-10-5(6)8/h2-3,5H,7-9H2,1H3 |
| InChIKey | DLNDHBCXELLLQE-UHFFFAOYSA-N |
| XLogP | -1.08 |
| TPSA | 90.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 140.19 |
| LogP ≤ 5 | -1.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |