C6H10N2 — CID 147313366
3-methyl-2,3-dihydropyridin-5-amine (PubChem CID 147313366) has the molecular formula C6H10N2 and a molecular weight of 110.16 g/mol. Its IUPAC name is 3-methyl-2,3-dihydropyridin-5-amine.
| Compound Name | 3-methyl-2,3-dihydropyridin-5-amine |
|---|---|
| PubChem CID | 147313366 |
| Molecular Formula | C6H10N2 |
| Molecular Weight | 110.16 g/mol |
| Exact Mass | 110.08 |
| IUPAC Name | 3-methyl-2,3-dihydropyridin-5-amine |
| SMILES | CC1C=C(N)C=NC1 |
| InChI | InChI=1S/C6H10N2/c1-5-2-6(7)4-8-3-5/h2,4-5H,3,7H2,1H3 |
| InChIKey | CYJZBJFOXHVVTH-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 110.16 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |