C7H12F2N2 — CID 138552377
(Z,1E)-1-(difluoromethylimino)-4-methylpent-2-en-3-amine (PubChem CID 138552377) has the molecular formula C7H12F2N2 and a molecular weight of 162.18 g/mol. Its IUPAC name is (Z,1E)-1-(difluoromethylimino)-4-methylpent-2-en-3-amine.
| Compound Name | (Z,1E)-1-(difluoromethylimino)-4-methylpent-2-en-3-amine |
|---|---|
| PubChem CID | 138552377 |
| Molecular Formula | C7H12F2N2 |
| Molecular Weight | 162.18 g/mol |
| Exact Mass | 162.10 |
| IUPAC Name | (Z,1E)-1-(difluoromethylimino)-4-methylpent-2-en-3-amine |
| SMILES | CC(C)/C(N)=C/C=N/C(F)F |
| InChI | InChI=1S/C7H12F2N2/c1-5(2)6(10)3-4-11-7(8)9/h3-5,7H,10H2,1-2H3/b6-3-,11-4+ |
| InChIKey | UZINPEHRSZZUFB-WVVGTSEZSA-N |
| XLogP | 1.78 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 162.18 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|