C5H8F2N2 — CID 146689609
1,1-difluoro-4-methyliminobut-2-en-2-amine (PubChem CID 146689609) has the molecular formula C5H8F2N2 and a molecular weight of 134.13 g/mol. Its IUPAC name is 1,1-difluoro-4-methyliminobut-2-en-2-amine.
| Compound Name | 1,1-difluoro-4-methyliminobut-2-en-2-amine |
|---|---|
| PubChem CID | 146689609 |
| Molecular Formula | C5H8F2N2 |
| Molecular Weight | 134.13 g/mol |
| Exact Mass | 134.07 |
| IUPAC Name | 1,1-difluoro-4-methyliminobut-2-en-2-amine |
| SMILES | C/N=C/C=C(N)C(F)F |
| InChI | InChI=1S/C5H8F2N2/c1-9-3-2-4(8)5(6)7/h2-3,5H,8H2,1H3/b4-2?,9-3+ |
| InChIKey | XRFAKTXMHRETAF-QITHCVSXSA-N |
| XLogP | 0.79 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 134.13 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|