C6H9N3 — CID 147720958
2-(methylideneamino)-2,3-dihydropyridin-5-amine (PubChem CID 147720958) has the molecular formula C6H9N3 and a molecular weight of 123.16 g/mol. Its IUPAC name is 2-(methylideneamino)-2,3-dihydropyridin-5-amine.
| Compound Name | 2-(methylideneamino)-2,3-dihydropyridin-5-amine |
|---|---|
| PubChem CID | 147720958 |
| Molecular Formula | C6H9N3 |
| Molecular Weight | 123.16 g/mol |
| Exact Mass | 123.08 |
| IUPAC Name | 2-(methylideneamino)-2,3-dihydropyridin-5-amine |
| SMILES | C=NC1CC=C(N)C=N1 |
| InChI | InChI=1S/C6H9N3/c1-8-6-3-2-5(7)4-9-6/h2,4,6H,1,3,7H2 |
| InChIKey | GWOGTYIXKDDPMF-UHFFFAOYSA-N |
| XLogP | 0.33 |
| TPSA | 50.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 123.16 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|