About 2-aminoethyl 2-diethoxyphosphanylacetate
2-aminoethyl 2-diethoxyphosphanylacetate (PubChem CID 155356816) has the molecular formula C8H18NO4P
and a molecular weight of 223.21 g/mol. Its IUPAC name is 2-aminoethyl 2-diethoxyphosphanylacetate.
Molecular Properties
| Compound Name | 2-aminoethyl 2-diethoxyphosphanylacetate |
| PubChem CID | 155356816 |
| Molecular Formula | C8H18NO4P |
| Molecular Weight | 223.21 g/mol |
| Exact Mass | 223.10 |
| IUPAC Name | 2-aminoethyl 2-diethoxyphosphanylacetate |
| SMILES | CCOP(CC(=O)OCCN)OCC |
| InChI | InChI=1S/C8H18NO4P/c1-3-12-14(13-4-2)7-8(10)11-6-5-9/h3-7,9H2,1-2H3 |
| InChIKey | JWYSVFYQLSOBMJ-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 70.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 223.21 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 2-aminoethyl 2-diethoxyphosphanylacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-aminoethyl 2-diethoxyphosphanylacetate?
The IUPAC name of 2-aminoethyl 2-diethoxyphosphanylacetate (CID 155356816) is 2-aminoethyl 2-diethoxyphosphanylacetate.
What is the SMILES notation for 2-aminoethyl 2-diethoxyphosphanylacetate?
The canonical SMILES for 2-aminoethyl 2-diethoxyphosphanylacetate is CCOP(CC(=O)OCCN)OCC.
What is the InChIKey of 2-aminoethyl 2-diethoxyphosphanylacetate?
The InChIKey is JWYSVFYQLSOBMJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H18NO4P/c1-3-12-14(13-4-2)7-8(10)11-6-5-9/h3-7,9H2,1-2H3.
What are the key properties of 2-aminoethyl 2-diethoxyphosphanylacetate?
2-aminoethyl 2-diethoxyphosphanylacetate has a molecular weight of 223.21 g/mol, XLogP of 0.87, 8 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-aminoethyl 2-diethoxyphosphanylacetate is sourced from PubChem (CID 155356816), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).