C26H27N5O2 — CID 155357179
1-[3-[8-amino-1-(4-cyclohexa-1,5-dien-1-yloxyphenyl)imidazo[1,5-a]pyrazin-3-yl]piperidin-1-yl]prop-2-en-1-one (PubChem CID 155357179) has the molecular formula C26H27N5O2 and a molecular weight of 441.54 g/mol. Its IUPAC name is 1-[3-[8-amino-1-(4-cyclohexa-1,5-dien-1-yloxyphenyl)imidazo[1,5-a]pyrazin-3-yl]piperidin-1-yl]prop-2-en-1-one.
| Compound Name | 1-[3-[8-amino-1-(4-cyclohexa-1,5-dien-1-yloxyphenyl)imidazo[1,5-a]pyrazin-3-yl]piperidin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 155357179 |
| Molecular Formula | C26H27N5O2 |
| Molecular Weight | 441.54 g/mol |
| Exact Mass | 441.22 |
| IUPAC Name | 1-[3-[8-amino-1-(4-cyclohexa-1,5-dien-1-yloxyphenyl)imidazo[1,5-a]pyrazin-3-yl]piperidin-1-yl]prop-2-en-1-one |
| SMILES | C=CC(=O)N1CCCC(c2nc(-c3ccc(OC4=CCCC=C4)cc3)c3c(N)nccn23)C1 |
| InChI | InChI=1S/C26H27N5O2/c1-2-22(32)30-15-6-7-19(17-30)26-29-23(24-25(27)28-14-16-31(24)26)18-10-12-21(13-11-18)33-20-8-4-3-5-9-20/h2,4,8-14,16,19H,1,3,5-7,15,17H2,(H2,27,28) |
| InChIKey | YFEAJTXVWCFCEZ-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 85.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.54 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|