C39H18F4N4O2 — CID 155366210
4-[3-[3,6-bis(1,3-benzoxazol-2-yl)carbazol-9-yl]phenyl]-2,3,5,6-tetrafluorobenzonitrile (PubChem CID 155366210) has the molecular formula C39H18F4N4O2 and a molecular weight of 650.59 g/mol. Its IUPAC name is 4-[3-[3,6-bis(1,3-benzoxazol-2-yl)carbazol-9-yl]phenyl]-2,3,5,6-tetrafluorobenzonitrile.
| Compound Name | 4-[3-[3,6-bis(1,3-benzoxazol-2-yl)carbazol-9-yl]phenyl]-2,3,5,6-tetrafluorobenzonitrile |
|---|---|
| PubChem CID | 155366210 |
| Molecular Formula | C39H18F4N4O2 |
| Molecular Weight | 650.59 g/mol |
| Exact Mass | 650.14 |
| IUPAC Name | 4-[3-[3,6-bis(1,3-benzoxazol-2-yl)carbazol-9-yl]phenyl]-2,3,5,6-tetrafluorobenzonitrile |
| SMILES | N#Cc1c(F)c(F)c(-c2cccc(-n3c4ccc(-c5nc6ccccc6o5)cc4c4cc(-c5nc6ccccc6o5)ccc43)c2)c(F)c1F |
| InChI | InChI=1S/C39H18F4N4O2/c40-34-26(19-44)35(41)37(43)33(36(34)42)20-6-5-7-23(16-20)47-29-14-12-21(38-45-27-8-1-3-10-31(27)48-38)17-24(29)25-18-22(13-15-30(25)47)39-46-28-9-2-4-11-32(28)49-39/h1-18H |
| InChIKey | ZLPDDJVQALYEIV-UHFFFAOYSA-N |
| XLogP | 10.50 |
| TPSA | 80.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 650.59 |
| LogP ≤ 5 | 10.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|