C20H18FN3O — CID 155369365
5-(3-fluorophenyl)-6-(oxan-4-yl)-1H-pyrrolo[2,3-f]indazole (PubChem CID 155369365) has the molecular formula C20H18FN3O and a molecular weight of 335.38 g/mol. Its IUPAC name is 5-(3-fluorophenyl)-6-(oxan-4-yl)-1H-pyrrolo[2,3-f]indazole.
| Compound Name | 5-(3-fluorophenyl)-6-(oxan-4-yl)-1H-pyrrolo[2,3-f]indazole |
|---|---|
| PubChem CID | 155369365 |
| Molecular Formula | C20H18FN3O |
| Molecular Weight | 335.38 g/mol |
| Exact Mass | 335.14 |
| IUPAC Name | 5-(3-fluorophenyl)-6-(oxan-4-yl)-1H-pyrrolo[2,3-f]indazole |
| SMILES | Fc1cccc(-n2c(C3CCOCC3)cc3cc4[nH]ncc4cc32)c1 |
| InChI | InChI=1S/C20H18FN3O/c21-16-2-1-3-17(11-16)24-19(13-4-6-25-7-5-13)9-14-8-18-15(10-20(14)24)12-22-23-18/h1-3,8-13H,4-7H2,(H,22,23) |
| InChIKey | MHDPGWSXRMYTRB-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 42.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.38 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |