C20H17F2N3O — CID 146522737
5-(3,4-difluorophenyl)-6-(oxan-4-yl)-1H-pyrrolo[2,3-f]indazole (PubChem CID 146522737) has the molecular formula C20H17F2N3O and a molecular weight of 353.37 g/mol. Its IUPAC name is 5-(3,4-difluorophenyl)-6-(oxan-4-yl)-1H-pyrrolo[2,3-f]indazole.
| Compound Name | 5-(3,4-difluorophenyl)-6-(oxan-4-yl)-1H-pyrrolo[2,3-f]indazole |
|---|---|
| PubChem CID | 146522737 |
| Molecular Formula | C20H17F2N3O |
| Molecular Weight | 353.37 g/mol |
| Exact Mass | 353.13 |
| IUPAC Name | 5-(3,4-difluorophenyl)-6-(oxan-4-yl)-1H-pyrrolo[2,3-f]indazole |
| SMILES | Fc1ccc(-n2c(C3CCOCC3)cc3cc4[nH]ncc4cc32)cc1F |
| InChI | InChI=1S/C20H17F2N3O/c21-16-2-1-15(10-17(16)22)25-19(12-3-5-26-6-4-12)8-13-7-18-14(9-20(13)25)11-23-24-18/h1-2,7-12H,3-6H2,(H,23,24) |
| InChIKey | NOAZHCHDPFMQPD-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 42.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.37 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |