About 5-(4-fluoro-3-methylphenyl)-6-(3-methyloxetan-3-yl)-1H-pyrrolo[2,3-f]indazole
5-(4-fluoro-3-methylphenyl)-6-(3-methyloxetan-3-yl)-1H-pyrrolo[2,3-f]indazole (PubChem CID 146522056) has the molecular formula C20H18FN3O
and a molecular weight of 335.38 g/mol. Its IUPAC name is 5-(4-fluoro-3-methylphenyl)-6-(3-methyloxetan-3-yl)-1H-pyrrolo[2,3-f]indazole.
Molecular Properties
| Compound Name | 5-(4-fluoro-3-methylphenyl)-6-(3-methyloxetan-3-yl)-1H-pyrrolo[2,3-f]indazole |
| PubChem CID | 146522056 |
| Molecular Formula | C20H18FN3O |
| Molecular Weight | 335.38 g/mol |
| Exact Mass | 335.14 |
| IUPAC Name | 5-(4-fluoro-3-methylphenyl)-6-(3-methyloxetan-3-yl)-1H-pyrrolo[2,3-f]indazole |
| SMILES | Cc1cc(-n2c(C3(C)COC3)cc3cc4[nH]ncc4cc32)ccc1F |
| InChI | InChI=1S/C20H18FN3O/c1-12-5-15(3-4-16(12)21)24-18-7-14-9-22-23-17(14)6-13(18)8-19(24)20(2)10-25-11-20/h3-9H,10-11H2,1-2H3,(H,22,23) |
| InChIKey | LCOBGAIHTBTUPX-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 42.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 335.38 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-(4-fluoro-3-methylphenyl)-6-(3-methyloxetan-3-yl)-1H-pyrrolo[2,3-f]indazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(4-fluoro-3-methylphenyl)-6-(3-methyloxetan-3-yl)-1H-pyrrolo[2,3-f]indazole?
The IUPAC name of 5-(4-fluoro-3-methylphenyl)-6-(3-methyloxetan-3-yl)-1H-pyrrolo[2,3-f]indazole (CID 146522056) is 5-(4-fluoro-3-methylphenyl)-6-(3-methyloxetan-3-yl)-1H-pyrrolo[2,3-f]indazole.
What is the SMILES notation for 5-(4-fluoro-3-methylphenyl)-6-(3-methyloxetan-3-yl)-1H-pyrrolo[2,3-f]indazole?
The canonical SMILES for 5-(4-fluoro-3-methylphenyl)-6-(3-methyloxetan-3-yl)-1H-pyrrolo[2,3-f]indazole is Cc1cc(-n2c(C3(C)COC3)cc3cc4[nH]ncc4cc32)ccc1F.
What is the InChIKey of 5-(4-fluoro-3-methylphenyl)-6-(3-methyloxetan-3-yl)-1H-pyrrolo[2,3-f]indazole?
The InChIKey is LCOBGAIHTBTUPX-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H18FN3O/c1-12-5-15(3-4-16(12)21)24-18-7-14-9-22-23-17(14)6-13(18)8-19(24)20(2)10-25-11-20/h3-9H,10-11H2,1-2H3,(H,22,23).
What are the key properties of 5-(4-fluoro-3-methylphenyl)-6-(3-methyloxetan-3-yl)-1H-pyrrolo[2,3-f]indazole?
5-(4-fluoro-3-methylphenyl)-6-(3-methyloxetan-3-yl)-1H-pyrrolo[2,3-f]indazole has a molecular weight of 335.38 g/mol, XLogP of 4.24, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(4-fluoro-3-methylphenyl)-6-(3-methyloxetan-3-yl)-1H-pyrrolo[2,3-f]indazole is sourced from PubChem (CID 146522056), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).