C22H24N10O4 — CID 155369623
(2S,3S,4R,5R)-5-[6-(cyclobutylamino)-2-(4-pyridin-2-yltriazol-1-yl)purin-9-yl]-3,4-dihydroxy-N-methyloxolane-2-carboxamide (PubChem CID 155369623) has the molecular formula C22H24N10O4 and a molecular weight of 492.50 g/mol. Its IUPAC name is (2S,3S,4R,5R)-5-[6-(cyclobutylamino)-2-(4-pyridin-2-yltriazol-1-yl)purin-9-yl]-3,4-dihydroxy-N-methyloxolane-2-carboxamide.
| Compound Name | (2S,3S,4R,5R)-5-[6-(cyclobutylamino)-2-(4-pyridin-2-yltriazol-1-yl)purin-9-yl]-3,4-dihydroxy-N-methyloxolane-2-carboxamide |
|---|---|
| PubChem CID | 155369623 |
| Molecular Formula | C22H24N10O4 |
| Molecular Weight | 492.50 g/mol |
| Exact Mass | 492.20 |
| IUPAC Name | (2S,3S,4R,5R)-5-[6-(cyclobutylamino)-2-(4-pyridin-2-yltriazol-1-yl)purin-9-yl]-3,4-dihydroxy-N-methyloxolane-2-carboxamide |
| SMILES | CNC(=O)[C@H]1O[C@@H](n2cnc3c(NC4CCC4)nc(-n4cc(-c5ccccn5)nn4)nc32)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C22H24N10O4/c1-23-20(35)17-15(33)16(34)21(36-17)31-10-25-14-18(26-11-5-4-6-11)27-22(28-19(14)31)32-9-13(29-30-32)12-7-2-3-8-24-12/h2-3,7-11,15-17,21,33-34H,4-6H2,1H3,(H,23,35)(H,26,27,28)/t15-,16+,17-,21+/m0/s1 |
| InChIKey | ODAUGUGRKNKLGR-GRXQJBFDSA-N |
| XLogP | -0.20 |
| TPSA | 178.02 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.50 |
| LogP ≤ 5 | -0.20 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 13 |