C19H20N8O4 — CID 102429610
(2S,3S,4R,5R)-2-[6-(methylamino)-2-(4-phenyltriazol-1-yl)purin-9-yl]oxane-3,4,5-triol (PubChem CID 102429610) has the molecular formula C19H20N8O4 and a molecular weight of 424.42 g/mol. Its IUPAC name is (2S,3S,4R,5R)-2-[6-(methylamino)-2-(4-phenyltriazol-1-yl)purin-9-yl]oxane-3,4,5-triol.
| Compound Name | (2S,3S,4R,5R)-2-[6-(methylamino)-2-(4-phenyltriazol-1-yl)purin-9-yl]oxane-3,4,5-triol |
|---|---|
| PubChem CID | 102429610 |
| Molecular Formula | C19H20N8O4 |
| Molecular Weight | 424.42 g/mol |
| Exact Mass | 424.16 |
| IUPAC Name | (2S,3S,4R,5R)-2-[6-(methylamino)-2-(4-phenyltriazol-1-yl)purin-9-yl]oxane-3,4,5-triol |
| SMILES | CNc1nc(-n2cc(-c3ccccc3)nn2)nc2c1ncn2[C@H]1OC[C@@H](O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C19H20N8O4/c1-20-16-13-17(26(9-21-13)18-15(30)14(29)12(28)8-31-18)23-19(22-16)27-7-11(24-25-27)10-5-3-2-4-6-10/h2-7,9,12,14-15,18,28-30H,8H2,1H3,(H,20,22,23)/t12-,14-,15+,18+/m1/s1 |
| InChIKey | MFMDBMSPQVYXNZ-TXPWEPMLSA-N |
| XLogP | -0.27 |
| TPSA | 156.26 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.42 |
| LogP ≤ 5 | -0.27 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |