C22H22ClN9O3 — CID 167161221
(1R,2R,3S,4R)-4-[2-[4-(2-chlorophenyl)triazol-1-yl]-6-(methylamino)purin-9-yl]-2,3-dihydroxy-N-methylbicyclo[3.1.0]hexane-1-carboxamide (PubChem CID 167161221) has the molecular formula C22H22ClN9O3 and a molecular weight of 495.93 g/mol. Its IUPAC name is (1R,2R,3S,4R)-4-[2-[4-(2-chlorophenyl)triazol-1-yl]-6-(methylamino)purin-9-yl]-2,3-dihydroxy-N-methylbicyclo[3.1.0]hexane-1-carboxamide.
| Compound Name | (1R,2R,3S,4R)-4-[2-[4-(2-chlorophenyl)triazol-1-yl]-6-(methylamino)purin-9-yl]-2,3-dihydroxy-N-methylbicyclo[3.1.0]hexane-1-carboxamide |
|---|---|
| PubChem CID | 167161221 |
| Molecular Formula | C22H22ClN9O3 |
| Molecular Weight | 495.93 g/mol |
| Exact Mass | 495.15 |
| IUPAC Name | (1R,2R,3S,4R)-4-[2-[4-(2-chlorophenyl)triazol-1-yl]-6-(methylamino)purin-9-yl]-2,3-dihydroxy-N-methylbicyclo[3.1.0]hexane-1-carboxamide |
| SMILES | CNC(=O)[C@]12CC1[C@@H](n1cnc3c(NC)nc(-n4cc(-c5ccccc5Cl)nn4)nc31)[C@H](O)[C@@H]2O |
| InChI | InChI=1S/C22H22ClN9O3/c1-24-18-14-19(28-21(27-18)32-8-13(29-30-32)10-5-3-4-6-12(10)23)31(9-26-14)15-11-7-22(11,20(35)25-2)17(34)16(15)33/h3-6,8-9,11,15-17,33-34H,7H2,1-2H3,(H,25,35)(H,24,27,28)/t11?,15-,16+,17+,22-/m1/s1 |
| InChIKey | LLQDFDPAVIHJQU-OJQXQRSESA-N |
| XLogP | 0.80 |
| TPSA | 155.90 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.93 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |