C28H54N4O2 — CID 155370066
3-[3-[(2S)-2-ethyl-2-hydroxy-3,3-dimethylnonyl]triazol-4-yl]-N-(5-methylnonan-5-yl)propanamide (PubChem CID 155370066) has the molecular formula C28H54N4O2 and a molecular weight of 478.77 g/mol. Its IUPAC name is 3-[3-[(2S)-2-ethyl-2-hydroxy-3,3-dimethylnonyl]triazol-4-yl]-N-(5-methylnonan-5-yl)propanamide.
| Compound Name | 3-[3-[(2S)-2-ethyl-2-hydroxy-3,3-dimethylnonyl]triazol-4-yl]-N-(5-methylnonan-5-yl)propanamide |
|---|---|
| PubChem CID | 155370066 |
| Molecular Formula | C28H54N4O2 |
| Molecular Weight | 478.77 g/mol |
| Exact Mass | 478.42 |
| IUPAC Name | 3-[3-[(2S)-2-ethyl-2-hydroxy-3,3-dimethylnonyl]triazol-4-yl]-N-(5-methylnonan-5-yl)propanamide |
| SMILES | CCCCCCC(C)(C)[C@@](O)(CC)Cn1nncc1CCC(=O)NC(C)(CCCC)CCCC |
| InChI | InChI=1S/C28H54N4O2/c1-8-12-15-16-19-26(5,6)28(34,11-4)23-32-24(22-29-31-32)17-18-25(33)30-27(7,20-13-9-2)21-14-10-3/h22,34H,8-21,23H2,1-7H3,(H,30,33)/t28-/m1/s1 |
| InChIKey | CWDOJYUZARDADU-MUUNZHRXSA-N |
| XLogP | 6.60 |
| TPSA | 80.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.77 |
| LogP ≤ 5 | 6.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|