C21H41N3O — CID 139460201
(3S)-3-[[5-(6,6-dimethyloctyl)triazol-1-yl]methyl]-4,4-dimethylhexan-3-ol (PubChem CID 139460201) has the molecular formula C21H41N3O and a molecular weight of 351.58 g/mol. Its IUPAC name is (3S)-3-[[5-(6,6-dimethyloctyl)triazol-1-yl]methyl]-4,4-dimethylhexan-3-ol.
| Compound Name | (3S)-3-[[5-(6,6-dimethyloctyl)triazol-1-yl]methyl]-4,4-dimethylhexan-3-ol |
|---|---|
| PubChem CID | 139460201 |
| Molecular Formula | C21H41N3O |
| Molecular Weight | 351.58 g/mol |
| Exact Mass | 351.32 |
| IUPAC Name | (3S)-3-[[5-(6,6-dimethyloctyl)triazol-1-yl]methyl]-4,4-dimethylhexan-3-ol |
| SMILES | CCC(C)(C)CCCCCc1cnnn1C[C@](O)(CC)C(C)(C)CC |
| InChI | InChI=1S/C21H41N3O/c1-8-19(4,5)15-13-11-12-14-18-16-22-23-24(18)17-21(25,10-3)20(6,7)9-2/h16,25H,8-15,17H2,1-7H3/t21-/m1/s1 |
| InChIKey | JSQOYGRYFKDAJF-OAQYLSRUSA-N |
| XLogP | 5.39 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.58 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|