C19H38N4O — CID 146352729
(3S)-2,2-dimethyl-3-[[5-[4-(2-methylbutan-2-ylamino)butyl]triazol-1-yl]methyl]pentan-3-ol (PubChem CID 146352729) has the molecular formula C19H38N4O and a molecular weight of 338.54 g/mol. Its IUPAC name is (3S)-2,2-dimethyl-3-[[5-[4-(2-methylbutan-2-ylamino)butyl]triazol-1-yl]methyl]pentan-3-ol.
| Compound Name | (3S)-2,2-dimethyl-3-[[5-[4-(2-methylbutan-2-ylamino)butyl]triazol-1-yl]methyl]pentan-3-ol |
|---|---|
| PubChem CID | 146352729 |
| Molecular Formula | C19H38N4O |
| Molecular Weight | 338.54 g/mol |
| Exact Mass | 338.30 |
| IUPAC Name | (3S)-2,2-dimethyl-3-[[5-[4-(2-methylbutan-2-ylamino)butyl]triazol-1-yl]methyl]pentan-3-ol |
| SMILES | CCC(C)(C)NCCCCc1cnnn1C[C@](O)(CC)C(C)(C)C |
| InChI | InChI=1S/C19H38N4O/c1-8-18(6,7)20-13-11-10-12-16-14-21-22-23(16)15-19(24,9-2)17(3,4)5/h14,20,24H,8-13,15H2,1-7H3/t19-/m1/s1 |
| InChIKey | FBCYUOPMNJKJPK-LJQANCHMSA-N |
| XLogP | 3.57 |
| TPSA | 62.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.54 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|