C10H21N3O7P2 — CID 162652083
[2-(5-hexyltriazol-1-yl)-1-hydroxy-1-phosphonoethyl]phosphonic acid (PubChem CID 162652083) has the molecular formula C10H21N3O7P2 and a molecular weight of 357.24 g/mol. Its IUPAC name is [2-(5-hexyltriazol-1-yl)-1-hydroxy-1-phosphonoethyl]phosphonic acid.
| Compound Name | [2-(5-hexyltriazol-1-yl)-1-hydroxy-1-phosphonoethyl]phosphonic acid |
|---|---|
| PubChem CID | 162652083 |
| Molecular Formula | C10H21N3O7P2 |
| Molecular Weight | 357.24 g/mol |
| Exact Mass | 357.09 |
| IUPAC Name | [2-(5-hexyltriazol-1-yl)-1-hydroxy-1-phosphonoethyl]phosphonic acid |
| SMILES | CCCCCCc1cnnn1CC(O)(P(=O)(O)O)P(=O)(O)O |
| InChI | InChI=1S/C10H21N3O7P2/c1-2-3-4-5-6-9-7-11-12-13(9)8-10(14,21(15,16)17)22(18,19)20/h7,14H,2-6,8H2,1H3,(H2,15,16,17)(H2,18,19,20) |
| InChIKey | GPAFQYUPOLCQDO-UHFFFAOYSA-N |
| XLogP | 0.40 |
| TPSA | 166.00 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.24 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|